C42H46N2O3S — CID 4104585
1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 4104585) has the molecular formula C42H46N2O3S and a molecular weight of 658.91 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 4104585 |
| Molecular Formula | C42H46N2O3S |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCc3c([nH]c4ccccc34)C2)c2ccc(cc2C(=O)c2cc3ccccc3s2)CC(O)CC1 |
| InChI | InChI=1S/C42H46N2O3S/c1-27-8-7-19-41(2)35(17-20-42(41,47)26-44-21-18-33-32-10-4-5-11-36(32)43-37(33)25-44)31-16-14-28(22-30(45)15-13-27)23-34(31)40(46)39-24-29-9-3-6-12-38(29)48-39/h3-6,8-12,14,16,23-24,30,35,43,45,47H,7,13,15,17-22,25-26H2,1-2H3 |
| InChIKey | PWBNVKWVFVFIDR-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|