C39H46F3NO6S2 — CID 3342857
N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 3342857) has the molecular formula C39H46F3NO6S2 and a molecular weight of 745.93 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3342857 |
| Molecular Formula | C39H46F3NO6S2 |
| Molecular Weight | 745.93 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CC1CCCO1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C39H46F3NO6S2/c1-34-13-10-27(44)21-36(34)16-17-38(29(22-36)33(45)25-6-3-7-26(20-25)39(40,41)42)30(34)11-14-35(2)31(38)12-15-37(35,46)24-43(23-28-8-4-18-49-28)51(47,48)32-9-5-19-50-32/h3,5-7,9,16-17,19-20,22,27-28,30-31,44,46H,4,8,10-15,18,21,23-24H2,1-2H3 |
| InChIKey | KCOKSDMBAAULSO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.93 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|