C38H45F2NO6S2 — CID 3342728
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 3342728) has the molecular formula C38H45F2NO6S2 and a molecular weight of 713.91 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3342728 |
| Molecular Formula | C38H45F2NO6S2 |
| Molecular Weight | 713.91 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CC1CCCO1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C38H45F2NO6S2/c1-34-12-9-25(42)20-36(34)15-16-38(27(21-36)33(43)24-7-8-28(39)29(40)19-24)30(34)10-13-35(2)31(38)11-14-37(35,44)23-41(22-26-5-3-17-47-26)49(45,46)32-6-4-18-48-32/h4,6-8,15-16,18-19,21,25-26,30-31,42,44H,3,5,9-14,17,20,22-23H2,1-2H3 |
| InChIKey | TVXJUOCLRIWOQC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|