C36H43F2NO5S2 — CID 3600805
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 3600805) has the molecular formula C36H43F2NO5S2 and a molecular weight of 671.87 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 3600805 |
| Molecular Formula | C36H43F2NO5S2 |
| Molecular Weight | 671.87 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C36H43F2NO5S2/c1-24-6-4-16-35(2)31(14-17-36(35,42)23-39(46(3,43)44)18-15-28-7-5-19-45-28)29-12-9-25(20-27(40)11-8-24)21-30(29)34(41)26-10-13-32(37)33(38)22-26/h5-7,9-10,12-13,19,21-22,27,31,40,42H,4,8,11,14-18,20,23H2,1-3H3 |
| InChIKey | BNVLLVQQCWBSRO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|