C39H48F3NO5S — CID 3367798
[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3367798) has the molecular formula C39H48F3NO5S and a molecular weight of 699.88 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3367798 |
| Molecular Formula | C39H48F3NO5S |
| Molecular Weight | 699.88 g/mol |
| Exact Mass | 699.32 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)CC(O)CO)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C39H48F3NO5S/c1-26-6-4-16-37(2)35(14-17-38(37,48)25-43(23-31(46)24-44)18-15-32-9-5-19-49-32)33-13-11-27(20-30(45)12-10-26)21-34(33)36(47)28-7-3-8-29(22-28)39(40,41)42/h3,5-9,11,13,19,21-22,30-31,35,44-46,48H,4,10,12,14-18,20,23-25H2,1-2H3 |
| InChIKey | RPRGFEAOSUQPAJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.88 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|