C45H51F3N2O4S — CID 3546614
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea (PubChem CID 3546614) has the molecular formula C45H51F3N2O4S and a molecular weight of 772.97 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3546614 |
| Molecular Formula | C45H51F3N2O4S |
| Molecular Weight | 772.97 g/mol |
| Exact Mass | 772.35 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)NC(C)c2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C45H51F3N2O4S/c1-30-10-8-22-43(3)40(38-19-17-32(26-36(51)18-16-30)27-39(38)41(52)34-13-7-14-35(28-34)45(46,47)48)20-23-44(43,54)29-50(24-21-37-15-9-25-55-37)42(53)49-31(2)33-11-5-4-6-12-33/h4-7,9-15,17,19,25,27-28,31,36,40,51,54H,8,16,18,20-24,26,29H2,1-3H3,(H,49,53) |
| InChIKey | WABRRGDFRUWDKD-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.97 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|