C46H51F3N2O4 — CID 3505644
1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)urea (PubChem CID 3505644) has the molecular formula C46H51F3N2O4 and a molecular weight of 752.92 g/mol. Its IUPAC name is 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 3505644 |
| Molecular Formula | C46H51F3N2O4 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)C(=O)NC(C)c2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C46H51F3N2O4/c1-31-12-11-24-44(3)41(39-22-20-34(26-38(52)21-19-31)27-40(39)42(53)36-17-10-18-37(28-36)46(47,48)49)23-25-45(44,55)30-51(29-33-13-6-4-7-14-33)43(54)50-32(2)35-15-8-5-9-16-35/h4-10,12-18,20,22,27-28,32,38,41,52,55H,11,19,21,23-26,29-30H2,1-3H3,(H,50,54) |
| InChIKey | HAOFIPRDGYXETI-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|