C45H51F3N2O4 — CID 3333957
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea (PubChem CID 3333957) has the molecular formula C45H51F3N2O4 and a molecular weight of 740.91 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3333957 |
| Molecular Formula | C45H51F3N2O4 |
| Molecular Weight | 740.91 g/mol |
| Exact Mass | 740.38 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(Cc1cccc2ccccc12)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C45H51F3N2O4/c1-28(2)49-39(53)50(26-31-12-7-10-29-9-5-6-14-34(29)31)27-43(54)20-17-37-41(43,4)19-16-36-40(3)18-15-33(51)24-42(40)21-22-44(36,37)35(25-42)38(52)30-11-8-13-32(23-30)45(46,47)48/h5-14,21-23,25,28,33,36-37,51,54H,15-20,24,26-27H2,1-4H3,(H,49,53) |
| InChIKey | QJTCBNTWPAOYCJ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.91 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|