C40H48F2N2O5 — CID 3484054
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea (PubChem CID 3484054) has the molecular formula C40H48F2N2O5 and a molecular weight of 674.83 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
|---|---|
| PubChem CID | 3484054 |
| Molecular Formula | C40H48F2N2O5 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C40H48F2N2O5/c1-36-15-12-28(45)23-38(36)18-19-40(29(24-38)34(46)26-10-11-30(41)31(42)22-26)32(36)13-16-37(2)33(40)14-17-39(37,48)25-44(20-7-21-49-3)35(47)43-27-8-5-4-6-9-27/h4-6,8-11,18-19,22,24,28,32-33,45,48H,7,12-17,20-21,23,25H2,1-3H3,(H,43,47) |
| InChIKey | VKWQULJRLWIREE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|