C44H48F3NO5 — CID 3477526
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(naphthalen-1-ylmethyl)carbamate (PubChem CID 3477526) has the molecular formula C44H48F3NO5 and a molecular weight of 727.86 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(naphthalen-1-ylmethyl)carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(naphthalen-1-ylmethyl)carbamate |
|---|---|
| PubChem CID | 3477526 |
| Molecular Formula | C44H48F3NO5 |
| Molecular Weight | 727.86 g/mol |
| Exact Mass | 727.35 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(naphthalen-1-ylmethyl)carbamate |
| SMILES | CCOC(=O)N(Cc1cccc2ccccc12)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C44H48F3NO5/c1-4-53-38(51)48(26-30-12-7-10-28-9-5-6-14-33(28)30)27-42(52)20-17-36-40(42,3)19-16-35-39(2)18-15-32(49)24-41(39)21-22-43(35,36)34(25-41)37(50)29-11-8-13-31(23-29)44(45,46)47/h5-14,21-23,25,32,35-36,49,52H,4,15-20,24,26-27H2,1-3H3 |
| InChIKey | JCULCRFQFKKAEK-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.86 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|