C42H43ClFNO4 — CID 3265414
17'-[2-(2-chloro-6-fluorophenyl)acetyl]-13'-hydroxy-6',10'-dimethyl-3-(naphthalen-1-ylmethyl)spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one (PubChem CID 3265414) has the molecular formula C42H43ClFNO4 and a molecular weight of 680.26 g/mol. Its IUPAC name is 17'-[2-(2-chloro-6-fluorophenyl)acetyl]-13'-hydroxy-6',10'-dimethyl-3-(naphthalen-1-ylmethyl)spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one.
| Compound Name | 17'-[2-(2-chloro-6-fluorophenyl)acetyl]-13'-hydroxy-6',10'-dimethyl-3-(naphthalen-1-ylmethyl)spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
|---|---|
| PubChem CID | 3265414 |
| Molecular Formula | C42H43ClFNO4 |
| Molecular Weight | 680.26 g/mol |
| Exact Mass | 679.29 |
| IUPAC Name | 17'-[2-(2-chloro-6-fluorophenyl)acetyl]-13'-hydroxy-6',10'-dimethyl-3-(naphthalen-1-ylmethyl)spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC21CN(Cc2cccc3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C42H43ClFNO4/c1-38-16-13-28(46)22-40(38)19-20-42(31(23-40)34(47)21-30-32(43)11-6-12-33(30)44)35(38)14-17-39(2)36(42)15-18-41(39)25-45(37(48)49-41)24-27-9-5-8-26-7-3-4-10-29(26)27/h3-12,19-20,23,28,35-36,46H,13-18,21-22,24-25H2,1-2H3 |
| InChIKey | XHYKQHJXJZKJPT-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.26 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|