C40H47ClFNO5 — CID 3564133
ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate (PubChem CID 3564133) has the molecular formula C40H47ClFNO5 and a molecular weight of 676.27 g/mol. Its IUPAC name is ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3564133 |
| Molecular Formula | C40H47ClFNO5 |
| Molecular Weight | 676.27 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C40H47ClFNO5/c1-4-48-38(46)43(25-28-11-6-5-7-12-28)26-40(47)21-19-34-31-18-16-29(22-30(44)17-15-27(2)10-9-20-39(34,40)3)23-32(31)37(45)24-33-35(41)13-8-14-36(33)42/h5-8,10-14,16,18,23,30,34,44,47H,4,9,15,17,19-22,24-26H2,1-3H3 |
| InChIKey | RZFKWABKKPVGMW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.27 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|