C42H47ClFNO5S — CID 3416462
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide (PubChem CID 3416462) has the molecular formula C42H47ClFNO5S and a molecular weight of 732.36 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 3416462 |
| Molecular Formula | C42H47ClFNO5S |
| Molecular Weight | 732.36 g/mol |
| Exact Mass | 731.28 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)S(C)(=O)=O)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C42H47ClFNO5S/c1-28-9-8-21-41(2)37(20-22-42(41,48)27-45(51(3,49)50)26-31-12-6-11-30-10-4-5-13-33(30)31)34-19-17-29(23-32(46)18-16-28)24-35(34)40(47)25-36-38(43)14-7-15-39(36)44/h4-7,9-15,17,19,24,32,37,46,48H,8,16,18,20-23,25-27H2,1-3H3 |
| InChIKey | XBQJZJIGCBONIN-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.36 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|