C44H51ClFNO5 — CID 3599303
2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(naphthalen-1-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone (PubChem CID 3599303) has the molecular formula C44H51ClFNO5 and a molecular weight of 728.35 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(naphthalen-1-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(naphthalen-1-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
|---|---|
| PubChem CID | 3599303 |
| Molecular Formula | C44H51ClFNO5 |
| Molecular Weight | 728.35 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(naphthalen-1-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)CC(O)CO)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C44H51ClFNO5/c1-29-8-7-20-43(2)39(19-21-44(43,52)28-47(26-34(50)27-48)25-32-11-5-10-31-9-3-4-12-35(31)32)36-18-16-30(22-33(49)17-15-29)23-37(36)42(51)24-38-40(45)13-6-14-41(38)46/h3-6,8-14,16,18,23,33-34,39,48-50,52H,7,15,17,19-22,24-28H2,1-2H3 |
| InChIKey | JGZPAEGCMIHCPM-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.35 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|