C46H53F2NO5 — CID 3303250
[5-[[benzyl-(2-hydroxy-3-phenylmethoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(3,4-difluorophenyl)methanone (PubChem CID 3303250) has the molecular formula C46H53F2NO5 and a molecular weight of 737.93 g/mol. Its IUPAC name is [5-[[benzyl-(2-hydroxy-3-phenylmethoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(3,4-difluorophenyl)methanone.
| Compound Name | [5-[[benzyl-(2-hydroxy-3-phenylmethoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 3303250 |
| Molecular Formula | C46H53F2NO5 |
| Molecular Weight | 737.93 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | [5-[[benzyl-(2-hydroxy-3-phenylmethoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(3,4-difluorophenyl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)CC(O)COCc2ccccc2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C46H53F2NO5/c1-32-10-9-22-45(2)41(39-19-16-35(24-37(50)18-15-32)25-40(39)44(52)36-17-20-42(47)43(48)26-36)21-23-46(45,53)31-49(27-33-11-5-3-6-12-33)28-38(51)30-54-29-34-13-7-4-8-14-34/h3-8,10-14,16-17,19-20,25-26,37-38,41,50-51,53H,9,15,18,21-24,27-31H2,1-2H3 |
| InChIKey | NPLORBAJAUHSEZ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.93 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|