C42H53F2NO5 — CID 3471064
(3,4-difluorophenyl)-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-propylamino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3471064) has the molecular formula C42H53F2NO5 and a molecular weight of 689.88 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-propylamino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-propylamino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3471064 |
| Molecular Formula | C42H53F2NO5 |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.39 |
| IUPAC Name | (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-propylamino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CCCN(CC(O)COCc1ccccc1)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C42H53F2NO5/c1-4-20-45(24-31(47)26-50-25-28-8-6-5-7-9-28)27-41(49)17-14-36-39(41,3)16-13-35-38(2)15-12-30(46)22-40(38)18-19-42(35,36)32(23-40)37(48)29-10-11-33(43)34(44)21-29/h5-11,18-19,21,23,30-31,35-36,46-47,49H,4,12-17,20,22,24-27H2,1-3H3 |
| InChIKey | CQHCKOOXZJSQIO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|