C41H47ClF3NO4 — CID 3321932
[5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3321932) has the molecular formula C41H47ClF3NO4 and a molecular weight of 710.28 g/mol. Its IUPAC name is [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3321932 |
| Molecular Formula | C41H47ClF3NO4 |
| Molecular Weight | 710.28 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | [5-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C41H47ClF3NO4/c1-35-13-10-30(47)23-37(35)16-17-40(31(24-37)34(48)26-4-3-5-28(22-26)41(43,44)45)32(35)11-14-36(2)33(40)12-15-39(36,50)25-46-20-18-38(49,19-21-46)27-6-8-29(42)9-7-27/h3-9,16-17,22,24,30,32-33,47,49-50H,10-15,18-21,23,25H2,1-2H3 |
| InChIKey | SXGTZCRDTKFBMH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.28 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|