C36H47F2NO3 — CID 3417820
[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone (PubChem CID 3417820) has the molecular formula C36H47F2NO3 and a molecular weight of 579.77 g/mol. Its IUPAC name is [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone.
| Compound Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 3417820 |
| Molecular Formula | C36H47F2NO3 |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCCCCC1 |
| InChI | InChI=1S/C36H47F2NO3/c1-32-13-10-25(40)21-34(32)16-17-36(26(22-34)31(41)24-8-9-27(37)28(38)20-24)29(32)11-14-33(2)30(36)12-15-35(33,42)23-39-18-6-4-3-5-7-19-39/h8-9,16-17,20,22,25,29-30,40,42H,3-7,10-15,18-19,21,23H2,1-2H3 |
| InChIKey | QFPPPTYIQVMMAO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|