C26H38FNO3 — CID 154927480
(13S,15R)-4-fluoro-15-[3-hydroxy-3-[(2-hydroxy-2-methylpropyl)-methylamino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 154927480) has the molecular formula C26H38FNO3 and a molecular weight of 431.59 g/mol. Its IUPAC name is (13S,15R)-4-fluoro-15-[3-hydroxy-3-[(2-hydroxy-2-methylpropyl)-methylamino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S,15R)-4-fluoro-15-[3-hydroxy-3-[(2-hydroxy-2-methylpropyl)-methylamino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154927480 |
| Molecular Formula | C26H38FNO3 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (13S,15R)-4-fluoro-15-[3-hydroxy-3-[(2-hydroxy-2-methylpropyl)-methylamino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(CC(C)(C)O)C(O)CCC1CC(=O)[C@@]2(C)CCC3c4cccc(F)c4CCC3C12 |
| InChI | InChI=1S/C26H38FNO3/c1-25(2,31)15-28(4)23(30)11-8-16-14-22(29)26(3)13-12-18-17-6-5-7-21(27)19(17)9-10-20(18)24(16)26/h5-7,16,18,20,23-24,30-31H,8-15H2,1-4H3/t16?,18?,20?,23?,24?,26-/m1/s1 |
| InChIKey | HZODGHBZCOKEIZ-KFFNXOTMSA-N |
| XLogP | 4.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|