C39H47F2NO5 — CID 3407942
[5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone (PubChem CID 3407942) has the molecular formula C39H47F2NO5 and a molecular weight of 647.80 g/mol. Its IUPAC name is [5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone.
| Compound Name | [5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 3407942 |
| Molecular Formula | C39H47F2NO5 |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | [5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C39H47F2NO5/c1-35-13-10-27(44)19-37(35)16-17-39(29(20-37)34(46)26-8-9-30(40)31(41)18-26)32(35)11-14-36(2)33(39)12-15-38(36,47)24-42(22-28(45)23-43)21-25-6-4-3-5-7-25/h3-9,16-18,20,27-28,32-33,43-45,47H,10-15,19,21-24H2,1-2H3 |
| InChIKey | NLOJEPSFUDISPT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|