C37H50F3NO6 — CID 3391611
[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3391611) has the molecular formula C37H50F3NO6 and a molecular weight of 661.80 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3391611 |
| Molecular Formula | C37H50F3NO6 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.36 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | COCCCN(CC(O)CO)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C37H50F3NO6/c1-32-11-8-26(43)19-34(32)14-15-36(28(20-34)31(45)24-6-4-7-25(18-24)37(38,39)40)29(32)9-12-33(2)30(36)10-13-35(33,46)23-41(16-5-17-47-3)21-27(44)22-42/h4,6-7,14-15,18,20,26-27,29-30,42-44,46H,5,8-13,16-17,19,21-23H2,1-3H3 |
| InChIKey | OBCVDIJYSVHQKW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|