C36H47F3N2O4 — CID 3269042
[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3269042) has the molecular formula C36H47F3N2O4 and a molecular weight of 628.78 g/mol. Its IUPAC name is [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3269042 |
| Molecular Formula | C36H47F3N2O4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(CCO)CC2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C36H47F3N2O4/c1-25-5-4-13-34(2)32(12-14-35(34,45)24-41-17-15-40(16-18-41)19-20-42)30-11-9-26(21-29(43)10-8-25)22-31(30)33(44)27-6-3-7-28(23-27)36(37,38)39/h3,5-7,9,11,22-23,29,32,42-43,45H,4,8,10,12-21,24H2,1-2H3 |
| InChIKey | SQNLTORAROYGEC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|