C35H44F2N2O4 — CID 3382289
1-[4-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 3382289) has the molecular formula C35H44F2N2O4 and a molecular weight of 594.74 g/mol. Its IUPAC name is 1-[4-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 3382289 |
| Molecular Formula | C35H44F2N2O4 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | 1-[4-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(F)c(F)c4)CC(O)CCC(C)=CCCC32C)CC1 |
| InChI | InChI=1S/C35H44F2N2O4/c1-23-5-4-13-34(3)30(12-14-35(34,43)22-38-15-17-39(18-16-38)24(2)40)28-10-7-25(19-27(41)9-6-23)20-29(28)33(42)26-8-11-31(36)32(37)21-26/h5,7-8,10-11,20-21,27,30,41,43H,4,6,9,12-19,22H2,1-3H3 |
| InChIKey | YTTWPIIUBBPOOA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|