C40H48F3NO6 — CID 3254585
[5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone (PubChem CID 3254585) has the molecular formula C40H48F3NO6 and a molecular weight of 695.82 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone.
| Compound Name | [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone |
|---|---|
| PubChem CID | 3254585 |
| Molecular Formula | C40H48F3NO6 |
| Molecular Weight | 695.82 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)CC(O)CO)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C40H48F3NO6/c1-27-7-6-19-38(2)36(34-17-13-29(21-31(46)14-10-27)22-35(34)37(48)30-8-4-3-5-9-30)18-20-39(38,49)26-44(24-32(47)25-45)23-28-11-15-33(16-12-28)50-40(41,42)43/h3-5,7-9,11-13,15-17,22,31-32,36,45-47,49H,6,10,14,18-21,23-26H2,1-2H3 |
| InChIKey | UBGSWDPODWHYBY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.82 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|