C36H47ClFNO6S — CID 4089142
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide (PubChem CID 4089142) has the molecular formula C36H47ClFNO6S and a molecular weight of 676.29 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 4089142 |
| Molecular Formula | C36H47ClFNO6S |
| Molecular Weight | 676.29 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)S(C)(=O)=O)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C36H47ClFNO6S/c1-24-7-5-16-35(2)31(15-17-36(35,42)23-39(46(3,43)44)22-27-8-6-18-45-27)28-14-12-25(19-26(40)13-11-24)20-29(28)34(41)21-30-32(37)9-4-10-33(30)38/h4,7,9-10,12,14,20,26-27,31,40,42H,5-6,8,11,13,15-19,21-23H2,1-3H3 |
| InChIKey | BFTNBVUUHBVXQN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|