C35H46F3NO6S — CID 3515475
N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide (PubChem CID 3515475) has the molecular formula C35H46F3NO6S and a molecular weight of 665.82 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide |
|---|---|
| PubChem CID | 3515475 |
| Molecular Formula | C35H46F3NO6S |
| Molecular Weight | 665.82 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC(C)=CCCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C35H46F3NO6S/c1-24-8-6-16-33(2)31(15-17-34(33,42)23-39(46(4,43)44)18-7-19-45-3)29-14-12-25(20-28(40)13-11-24)21-30(29)32(41)26-9-5-10-27(22-26)35(36,37)38/h5,8-10,12,14,21-22,28,31,40,42H,6-7,11,13,15-20,23H2,1-4H3 |
| InChIKey | OOYGPQFTAPTBNH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.82 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|