C38H45F2NO3 — CID 3515473
(3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 3515473) has the molecular formula C38H45F2NO3 and a molecular weight of 601.78 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 3515473 |
| Molecular Formula | C38H45F2NO3 |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.34 |
| IUPAC Name | (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(C)CCc2ccccc2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C38H45F2NO3/c1-26-8-7-19-37(2)33(17-20-38(37,44)25-41(3)21-18-27-9-5-4-6-10-27)31-15-12-28(22-30(42)14-11-26)23-32(31)36(43)29-13-16-34(39)35(40)24-29/h4-6,8-10,12-13,15-16,23-24,30,33,42,44H,7,11,14,17-22,25H2,1-3H3 |
| InChIKey | SHLVEINATBWTRR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|