C37H51ClFNO6 — CID 3593031
2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone (PubChem CID 3593031) has the molecular formula C37H51ClFNO6 and a molecular weight of 660.27 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
|---|---|
| PubChem CID | 3593031 |
| Molecular Formula | C37H51ClFNO6 |
| Molecular Weight | 660.27 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
| SMILES | COCCCN(CC(O)CO)CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C37H51ClFNO6/c1-25-7-5-15-36(2)32(14-16-37(36,45)24-40(17-6-18-46-3)22-28(43)23-41)29-13-11-26(19-27(42)12-10-25)20-30(29)35(44)21-31-33(38)8-4-9-34(31)39/h4,7-9,11,13,20,27-28,32,41-43,45H,5-6,10,12,14-19,21-24H2,1-3H3 |
| InChIKey | ZHMDVZGVECNZHP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.27 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|