C33H43F2NO5S — CID 3638294
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide (PubChem CID 3638294) has the molecular formula C33H43F2NO5S and a molecular weight of 603.77 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 3638294 |
| Molecular Formula | C33H43F2NO5S |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C33H43F2NO5S/c1-5-17-36(42(4,40)41)21-33(39)16-14-28-26-12-9-23(18-25(37)11-8-22(2)7-6-15-32(28,33)3)19-27(26)31(38)24-10-13-29(34)30(35)20-24/h7,9-10,12-13,19-20,25,28,37,39H,5-6,8,11,14-18,21H2,1-4H3 |
| InChIKey | KWNCYTUQGJBLSO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|