C45H52ClFN2O4 — CID 4085987
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea (PubChem CID 4085987) has the molecular formula C45H52ClFN2O4 and a molecular weight of 739.37 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 4085987 |
| Molecular Formula | C45H52ClFN2O4 |
| Molecular Weight | 739.37 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)C(=O)NC(C)C)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C45H52ClFN2O4/c1-29(2)48-43(52)49(27-33-13-7-12-32-11-5-6-14-35(32)33)28-45(53)23-21-39-36-20-18-31(24-34(50)19-17-30(3)10-9-22-44(39,45)4)25-37(36)42(51)26-38-40(46)15-8-16-41(38)47/h5-8,10-16,18,20,25,29,34,39,50,53H,9,17,19,21-24,26-28H2,1-4H3,(H,48,52) |
| InChIKey | LQFQJKXNGVUCKH-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.37 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|