C41H50ClFN2O5 — CID 3315162
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-phenylurea (PubChem CID 3315162) has the molecular formula C41H50ClFN2O5 and a molecular weight of 705.31 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-phenylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
|---|---|
| PubChem CID | 3315162 |
| Molecular Formula | C41H50ClFN2O5 |
| Molecular Weight | 705.31 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C41H50ClFN2O5/c1-28-10-8-20-40(2)35(19-21-41(40,49)27-45(22-9-23-50-3)39(48)44-30-11-5-4-6-12-30)32-18-16-29(24-31(46)17-15-28)25-33(32)38(47)26-34-36(42)13-7-14-37(34)43/h4-7,10-14,16,18,25,31,35,46,49H,8-9,15,17,19-24,26-27H2,1-3H3,(H,44,48) |
| InChIKey | AOYYKANJZOJGEA-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.31 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|