C40H48ClFN2O4 — CID 3631746
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea (PubChem CID 3631746) has the molecular formula C40H48ClFN2O4 and a molecular weight of 675.29 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea |
|---|---|
| PubChem CID | 3631746 |
| Molecular Formula | C40H48ClFN2O4 |
| Molecular Weight | 675.29 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C40H48ClFN2O4/c1-4-22-44(38(47)43-29-11-6-5-7-12-29)26-40(48)21-19-34-31-18-16-28(23-30(45)17-15-27(2)10-9-20-39(34,40)3)24-32(31)37(46)25-33-35(41)13-8-14-36(33)42/h5-8,10-14,16,18,24,30,34,45,48H,4,9,15,17,19-23,25-26H2,1-3H3,(H,43,47) |
| InChIKey | HKNMZQVIOUWFKN-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.29 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|