C38H52ClFN2O5 — CID 3596869
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea (PubChem CID 3596869) has the molecular formula C38H52ClFN2O5 and a molecular weight of 671.29 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3596869 |
| Molecular Formula | C38H52ClFN2O5 |
| Molecular Weight | 671.29 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)NC(C)C |
| InChI | InChI=1S/C38H52ClFN2O5/c1-25(2)41-36(45)42(19-8-20-47-5)24-38(46)18-16-32-29-15-13-27(21-28(43)14-12-26(3)9-7-17-37(32,38)4)22-30(29)35(44)23-31-33(39)10-6-11-34(31)40/h6,9-11,13,15,22,25,28,32,43,46H,7-8,12,14,16-21,23-24H2,1-5H3,(H,41,45) |
| InChIKey | HKNYIMXBWJKVCP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.29 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|