C39H51F3N2O5 — CID 3468028
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea (PubChem CID 3468028) has the molecular formula C39H51F3N2O5 and a molecular weight of 684.84 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3468028 |
| Molecular Formula | C39H51F3N2O5 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)NC(C)C)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C39H51F3N2O5/c1-25(2)43-36(47)44(23-31-11-7-19-49-31)24-38(48)18-16-34-32-15-13-27(20-30(45)14-12-26(3)8-6-17-37(34,38)4)21-33(32)35(46)28-9-5-10-29(22-28)39(40,41)42/h5,8-10,13,15,21-22,25,30-31,34,45,48H,6-7,11-12,14,16-20,23-24H2,1-4H3,(H,43,47) |
| InChIKey | MYZCENNEWCYXDF-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|