C44H47F3N2O4 — CID 3403294
1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea (PubChem CID 3403294) has the molecular formula C44H47F3N2O4 and a molecular weight of 724.86 g/mol. Its IUPAC name is 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea.
| Compound Name | 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 3403294 |
| Molecular Formula | C44H47F3N2O4 |
| Molecular Weight | 724.86 g/mol |
| Exact Mass | 724.35 |
| IUPAC Name | 1-benzyl-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C44H47F3N2O4/c1-30-11-10-23-42(2)39(22-24-43(42,53)29-49(28-31-12-5-3-6-13-31)41(52)48-35-16-7-4-8-17-35)37-21-19-32(25-36(50)20-18-30)26-38(37)40(51)33-14-9-15-34(27-33)44(45,46)47/h3-9,11-17,19,21,26-27,36,39,50,53H,10,18,20,22-25,28-29H2,1-2H3,(H,48,52) |
| InChIKey | NLBPBKBIGDTQDJ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.86 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|