C50H51F3N2O5 — CID 3391613
1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3391613) has the molecular formula C50H51F3N2O5 and a molecular weight of 816.96 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3391613 |
| Molecular Formula | C50H51F3N2O5 |
| Molecular Weight | 816.96 g/mol |
| Exact Mass | 816.38 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2ccc(-c3ccccc3)cc2)CC(O)CC1 |
| InChI | InChI=1S/C50H51F3N2O5/c1-34-10-9-28-48(2)45(43-26-18-36(30-41(56)23-15-34)31-44(43)46(57)39-21-19-38(20-22-39)37-11-5-3-6-12-37)27-29-49(48,59)33-55(47(58)54-40-13-7-4-8-14-40)32-35-16-24-42(25-17-35)60-50(51,52)53/h3-8,10-14,16-22,24-26,31,41,45,56,59H,9,15,23,27-30,32-33H2,1-2H3,(H,54,58) |
| InChIKey | APOUYSGXSJFDEI-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.96 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|