C37H39F2NO4 — CID 3597937
3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one (PubChem CID 3597937) has the molecular formula C37H39F2NO4 and a molecular weight of 599.72 g/mol. Its IUPAC name is 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one.
| Compound Name | 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
|---|---|
| PubChem CID | 3597937 |
| Molecular Formula | C37H39F2NO4 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC21CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C37H39F2NO4/c1-33-13-10-25(41)19-35(33)16-17-37(26(20-35)31(42)24-8-9-27(38)28(39)18-24)29(33)11-14-34(2)30(37)12-15-36(34)22-40(32(43)44-36)21-23-6-4-3-5-7-23/h3-9,16-18,20,25,29-30,41H,10-15,19,21-22H2,1-2H3 |
| InChIKey | HZJQNWOKRMGSKT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|