C44H50F2N2O4S — CID 3603176
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea (PubChem CID 3603176) has the molecular formula C44H50F2N2O4S and a molecular weight of 740.96 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3603176 |
| Molecular Formula | C44H50F2N2O4S |
| Molecular Weight | 740.96 g/mol |
| Exact Mass | 740.35 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)NC(C)c2ccccc2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C44H50F2N2O4S/c1-29-9-7-21-43(3)38(36-17-14-31(25-34(49)16-13-29)26-37(36)41(50)33-15-18-39(45)40(46)27-33)19-22-44(43,52)28-48(23-20-35-12-8-24-53-35)42(51)47-30(2)32-10-5-4-6-11-32/h4-6,8-12,14-15,17-18,24,26-27,30,34,38,49,52H,7,13,16,19-23,25,28H2,1-3H3,(H,47,51) |
| InChIKey | SVFVQECWAUDLGB-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.96 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|