C29H27FN2O2S — CID 91179224
2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(2-thiophen-2-ylethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide (PubChem CID 91179224) has the molecular formula C29H27FN2O2S and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(2-thiophen-2-ylethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide.
| Compound Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(2-thiophen-2-ylethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 91179224 |
| Molecular Formula | C29H27FN2O2S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(2-thiophen-2-ylethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
| SMILES | O=C(N[C@@H]1c2cc(CNCCc3cccs3)ccc2C[C@H]1O)c1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C29H27FN2O2S/c30-26-16-21(20-5-2-1-3-6-20)10-11-24(26)29(34)32-28-25-15-19(8-9-22(25)17-27(28)33)18-31-13-12-23-7-4-14-35-23/h1-11,14-16,27-28,31,33H,12-13,17-18H2,(H,32,34)/t27-,28-/m1/s1 |
| InChIKey | SLYITIQVDWGOOB-VSGBNLITSA-N |
| XLogP | 5.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|