C36H48F3NO5 — CID 3651449
[5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3651449) has the molecular formula C36H48F3NO5 and a molecular weight of 631.78 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3651449 |
| Molecular Formula | C36H48F3NO5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CCCN(CC(O)CO)CC1(O)CCC2c3ccc(cc3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C36H48F3NO5/c1-4-17-40(21-29(43)22-41)23-35(45)16-14-32-30-13-11-25(18-28(42)12-10-24(2)7-6-15-34(32,35)3)19-31(30)33(44)26-8-5-9-27(20-26)36(37,38)39/h5,7-9,11,13,19-20,28-29,32,41-43,45H,4,6,10,12,14-18,21-23H2,1-3H3 |
| InChIKey | YYMSFYNEIUSBHT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|