C38H45F2NO6S2 — CID 4089239
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 4089239) has the molecular formula C38H45F2NO6S2 and a molecular weight of 713.91 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4089239 |
| Molecular Formula | C38H45F2NO6S2 |
| Molecular Weight | 713.91 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C38H45F2NO6S2/c1-25-6-3-16-37(2)32(15-17-38(37,44)24-41(23-29-7-4-18-47-29)49(45,46)35-8-5-19-48-35)30-13-10-26(20-28(42)12-9-25)21-31(30)36(43)27-11-14-33(39)34(40)22-27/h5-6,8,10-11,13-14,19,21-22,28-29,32,42,44H,3-4,7,9,12,15-18,20,23-24H2,1-2H3 |
| InChIKey | SAJWTWZKCFNXTB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.91 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|