C41H44F3NO6S2 — CID 3492524
N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 3492524) has the molecular formula C41H44F3NO6S2 and a molecular weight of 767.93 g/mol. Its IUPAC name is N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3492524 |
| Molecular Formula | C41H44F3NO6S2 |
| Molecular Weight | 767.93 g/mol |
| Exact Mass | 767.26 |
| IUPAC Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C41H44F3NO6S2/c1-28-8-6-21-39(2)36(34-19-15-30(24-32(46)16-12-28)25-35(34)38(47)31-9-4-3-5-10-31)20-22-40(39,48)27-45(53(49,50)37-11-7-23-52-37)26-29-13-17-33(18-14-29)51-41(42,43)44/h3-5,7-11,13-15,17-19,23,25,32,36,46,48H,6,12,16,20-22,24,26-27H2,1-2H3 |
| InChIKey | BXQWARBMPHGTDG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.93 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|