C39H46F3NO7S — CID 3645706
N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide (PubChem CID 3645706) has the molecular formula C39H46F3NO7S and a molecular weight of 729.86 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 3645706 |
| Molecular Formula | C39H46F3NO7S |
| Molecular Weight | 729.86 g/mol |
| Exact Mass | 729.29 |
| IUPAC Name | N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
| SMILES | COc1ccc(C(=O)c2cc3ccc2C2CCC(O)(CN(Cc4ccc(OC(F)(F)F)cc4)S(C)(=O)=O)C2(C)CCC=C(C)CCC(O)C3)cc1 |
| InChI | InChI=1S/C39H46F3NO7S/c1-26-6-5-20-37(2)35(19-21-38(37,46)25-43(51(4,47)48)24-27-8-14-32(15-9-27)50-39(40,41)42)33-18-10-28(22-30(44)13-7-26)23-34(33)36(45)29-11-16-31(49-3)17-12-29/h6,8-12,14-18,23,30,35,44,46H,5,7,13,19-22,24-25H2,1-4H3 |
| InChIKey | KGDDAQPICNBKLQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.86 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|