C41H52N2O6 — CID 6667647
1-[[(2S,5S,6S,13S)-5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-propylurea (PubChem CID 6667647) has the molecular formula C41H52N2O6 and a molecular weight of 668.88 g/mol. Its IUPAC name is 1-[[(2S,5S,6S,13S)-5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-propylurea.
| Compound Name | 1-[[(2S,5S,6S,13S)-5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-propylurea |
|---|---|
| PubChem CID | 6667647 |
| Molecular Formula | C41H52N2O6 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 1-[[(2S,5S,6S,13S)-5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-propylurea |
| SMILES | CCCN(C[C@]1(O)CC[C@H]2c3ccc(cc3C(=O)c3ccc(OC)cc3)C[C@@H](O)CCC(C)=CCC[C@@]21C)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C41H52N2O6/c1-6-24-43(39(46)42-31-13-18-34(49-5)19-14-31)27-41(47)23-21-37-35-20-10-29(25-32(44)15-9-28(2)8-7-22-40(37,41)3)26-36(35)38(45)30-11-16-33(48-4)17-12-30/h8,10-14,16-20,26,32,37,44,47H,6-7,9,15,21-25,27H2,1-5H3,(H,42,46)/t32-,37-,40-,41+/m0/s1 |
| InChIKey | UZVVBDKSIPKQQT-KWPYSKFVSA-N |
| XLogP | 7.92 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|