C42H54N2O5 — CID 3631954
1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea (PubChem CID 3631954) has the molecular formula C42H54N2O5 and a molecular weight of 666.90 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea.
| Compound Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea |
|---|---|
| PubChem CID | 3631954 |
| Molecular Formula | C42H54N2O5 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(OC)cc3)CC(O)CCC(C)=CCCC21C)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C42H54N2O5/c1-6-25-44(40(47)43-30(3)32-12-8-7-9-13-32)28-42(48)24-22-38-36-21-15-31(26-34(45)18-14-29(2)11-10-23-41(38,42)4)27-37(36)39(46)33-16-19-35(49-5)20-17-33/h7-9,11-13,15-17,19-21,27,30,34,38,45,48H,6,10,14,18,22-26,28H2,1-5H3,(H,43,47) |
| InChIKey | KOJZRQGBDVJUEC-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|