C43H54N2O5 — CID 4065298
1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-phenylethyl)urea (PubChem CID 4065298) has the molecular formula C43H54N2O5 and a molecular weight of 678.91 g/mol. Its IUPAC name is 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-phenylethyl)urea.
| Compound Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 4065298 |
| Molecular Formula | C43H54N2O5 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-phenylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)NC(C)c2ccccc2)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C43H54N2O5/c1-30-12-10-23-42(3)39(37-21-19-32(26-35(46)20-18-30)27-38(37)40(47)34-15-8-5-9-16-34)22-24-43(42,49)29-45(28-36-17-11-25-50-36)41(48)44-31(2)33-13-6-4-7-14-33/h4-9,12-16,19,21,27,31,35-36,39,46,49H,10-11,17-18,20,22-26,28-29H2,1-3H3,(H,44,48) |
| InChIKey | GJQDHKJUGKSILS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|