C37H55NO6 — CID 6727911
ethyl N-[[(2S,5S,6S,13S)-17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]carbamate (PubChem CID 6727911) has the molecular formula C37H55NO6 and a molecular weight of 609.85 g/mol. Its IUPAC name is ethyl N-[[(2S,5S,6S,13S)-17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]carbamate.
| Compound Name | ethyl N-[[(2S,5S,6S,13S)-17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 6727911 |
| Molecular Formula | C37H55NO6 |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.40 |
| IUPAC Name | ethyl N-[[(2S,5S,6S,13S)-17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]carbamate |
| SMILES | CCOC(=O)N(C[C@H]1CCCO1)C[C@]1(O)CC[C@H]2c3ccc(cc3C(=O)C3CCCCC3)C[C@@H](O)CCC(C)=CCC[C@@]21C |
| InChI | InChI=1S/C37H55NO6/c1-4-43-35(41)38(24-30-13-9-21-44-30)25-37(42)20-18-33-31-17-15-27(23-32(31)34(40)28-11-6-5-7-12-28)22-29(39)16-14-26(2)10-8-19-36(33,37)3/h10,15,17,23,28-30,33,39,42H,4-9,11-14,16,18-22,24-25H2,1-3H3/t29-,30+,33-,36-,37+/m0/s1 |
| InChIKey | UDMFRUJGYCWHFE-VEBZFWAESA-N |
| XLogP | 7.13 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|