C44H63NO6 — CID 3382292
cyclohexyl-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-(oxolan-2-ylmethyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 3382292) has the molecular formula C44H63NO6 and a molecular weight of 701.99 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-(oxolan-2-ylmethyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-(oxolan-2-ylmethyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 3382292 |
| Molecular Formula | C44H63NO6 |
| Molecular Weight | 701.99 g/mol |
| Exact Mass | 701.47 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-5-[[(2-hydroxy-3-phenylmethoxypropyl)-(oxolan-2-ylmethyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC(O)COCc2ccccc2)CC2CCCO2)c2ccc(cc2C(=O)C2CCCCC2)CC(O)CC1 |
| InChI | InChI=1S/C44H63NO6/c1-32-11-9-22-43(2)41(39-20-18-34(25-36(46)19-17-32)26-40(39)42(48)35-14-7-4-8-15-35)21-23-44(43,49)31-45(28-38-16-10-24-51-38)27-37(47)30-50-29-33-12-5-3-6-13-33/h3,5-6,11-13,18,20,26,35-38,41,46-47,49H,4,7-10,14-17,19,21-25,27-31H2,1-2H3 |
| InChIKey | KEBSKSGKAREBSW-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.99 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|