C41H55F3N2O5 — CID 4999642
1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 4999642) has the molecular formula C41H55F3N2O5 and a molecular weight of 712.89 g/mol. Its IUPAC name is 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 4999642 |
| Molecular Formula | C41H55F3N2O5 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.41 |
| IUPAC Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)NC(C)C)c2ccc(cc2C(=O)C2CCCCC2)CC(O)CC1 |
| InChI | InChI=1S/C41H55F3N2O5/c1-27(2)45-38(49)46(25-29-13-17-33(18-14-29)51-41(42,43)44)26-40(50)22-20-36-34-19-15-30(24-35(34)37(48)31-10-6-5-7-11-31)23-32(47)16-12-28(3)9-8-21-39(36,40)4/h9,13-15,17-19,24,27,31-32,36,47,50H,5-8,10-12,16,20-23,25-26H2,1-4H3,(H,45,49) |
| InChIKey | ISXDUGVXERPRJR-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|