C39H46F3NO6S — CID 5221131
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 5221131) has the molecular formula C39H46F3NO6S and a molecular weight of 713.86 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 5221131 |
| Molecular Formula | C39H46F3NO6S |
| Molecular Weight | 713.86 g/mol |
| Exact Mass | 713.30 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccc(OC(F)(F)F)cc1)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(C)s3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C39H46F3NO6S/c1-5-48-36(46)43(23-27-10-14-30(15-11-27)49-39(40,41)42)24-38(47)20-18-33-31-16-12-28(22-32(31)35(45)34-17-9-26(3)50-34)21-29(44)13-8-25(2)7-6-19-37(33,38)4/h7,9-12,14-17,22,29,33,44,47H,5-6,8,13,18-21,23-24H2,1-4H3 |
| InChIKey | YDYXHZSSGITHHU-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.86 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|